C16H21N3O3 — CID 166424346
N-[[1-(2-methoxyethyl)pyrazol-4-yl]methyl]-N-[(5-methylfuran-3-yl)methyl]prop-2-enamide (PubChem CID 166424346) has the molecular formula C16H21N3O3 and a molecular weight of 303.36 g/mol. Its IUPAC name is N-[[1-(2-methoxyethyl)pyrazol-4-yl]methyl]-N-[(5-methylfuran-3-yl)methyl]prop-2-enamide.
| Compound Name | N-[[1-(2-methoxyethyl)pyrazol-4-yl]methyl]-N-[(5-methylfuran-3-yl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 166424346 |
| Molecular Formula | C16H21N3O3 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | N-[[1-(2-methoxyethyl)pyrazol-4-yl]methyl]-N-[(5-methylfuran-3-yl)methyl]prop-2-enamide |
| SMILES | C=CC(=O)N(Cc1coc(C)c1)Cc1cnn(CCOC)c1 |
| InChI | InChI=1S/C16H21N3O3/c1-4-16(20)18(9-14-7-13(2)22-12-14)10-15-8-17-19(11-15)5-6-21-3/h4,7-8,11-12H,1,5-6,9-10H2,2-3H3 |
| InChIKey | CIXNYEMTSZAGFH-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 60.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|