C13H15FN4O2S — CID 166424353
N-[1-(2-fluoroethyl)pyrazol-4-yl]-N-[(3-methoxy-1,2-thiazol-5-yl)methyl]prop-2-enamide (PubChem CID 166424353) has the molecular formula C13H15FN4O2S and a molecular weight of 310.35 g/mol. Its IUPAC name is N-[1-(2-fluoroethyl)pyrazol-4-yl]-N-[(3-methoxy-1,2-thiazol-5-yl)methyl]prop-2-enamide.
| Compound Name | N-[1-(2-fluoroethyl)pyrazol-4-yl]-N-[(3-methoxy-1,2-thiazol-5-yl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 166424353 |
| Molecular Formula | C13H15FN4O2S |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | N-[1-(2-fluoroethyl)pyrazol-4-yl]-N-[(3-methoxy-1,2-thiazol-5-yl)methyl]prop-2-enamide |
| SMILES | C=CC(=O)N(Cc1cc(OC)ns1)c1cnn(CCF)c1 |
| InChI | InChI=1S/C13H15FN4O2S/c1-3-13(19)18(9-11-6-12(20-2)16-21-11)10-7-15-17(8-10)5-4-14/h3,6-8H,1,4-5,9H2,2H3 |
| InChIKey | ANKZYSDEYHFGDF-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|