C17H19N3O2 — CID 154880629
N-(2,3-dihydro-1-benzofuran-5-ylmethyl)-N-(1-ethylpyrazol-4-yl)prop-2-enamide (PubChem CID 154880629) has the molecular formula C17H19N3O2 and a molecular weight of 297.36 g/mol. Its IUPAC name is N-(2,3-dihydro-1-benzofuran-5-ylmethyl)-N-(1-ethylpyrazol-4-yl)prop-2-enamide.
| Compound Name | N-(2,3-dihydro-1-benzofuran-5-ylmethyl)-N-(1-ethylpyrazol-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 154880629 |
| Molecular Formula | C17H19N3O2 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | N-(2,3-dihydro-1-benzofuran-5-ylmethyl)-N-(1-ethylpyrazol-4-yl)prop-2-enamide |
| SMILES | C=CC(=O)N(Cc1ccc2c(c1)CCO2)c1cnn(CC)c1 |
| InChI | InChI=1S/C17H19N3O2/c1-3-17(21)20(15-10-18-19(4-2)12-15)11-13-5-6-16-14(9-13)7-8-22-16/h3,5-6,9-10,12H,1,4,7-8,11H2,2H3 |
| InChIKey | XHGWLZVCLNNSQG-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|