About N-ethyl-N-(3,4,5-trimethoxyphenyl)prop-2-enamide
N-ethyl-N-(3,4,5-trimethoxyphenyl)prop-2-enamide (PubChem CID 175533762) has the molecular formula C14H19NO4
and a molecular weight of 265.31 g/mol. Its IUPAC name is N-ethyl-N-(3,4,5-trimethoxyphenyl)prop-2-enamide.
Molecular Properties
| Compound Name | N-ethyl-N-(3,4,5-trimethoxyphenyl)prop-2-enamide |
| PubChem CID | 175533762 |
| Molecular Formula | C14H19NO4 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | N-ethyl-N-(3,4,5-trimethoxyphenyl)prop-2-enamide |
| SMILES | C=CC(=O)N(CC)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C14H19NO4/c1-6-13(16)15(7-2)10-8-11(17-3)14(19-5)12(9-10)18-4/h6,8-9H,1,7H2,2-5H3 |
| InChIKey | VESGVKZURFMXDD-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-N-(3,4,5-trimethoxyphenyl)prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N-(3,4,5-trimethoxyphenyl)prop-2-enamide?
The IUPAC name of N-ethyl-N-(3,4,5-trimethoxyphenyl)prop-2-enamide (CID 175533762) is N-ethyl-N-(3,4,5-trimethoxyphenyl)prop-2-enamide.
What is the SMILES notation for N-ethyl-N-(3,4,5-trimethoxyphenyl)prop-2-enamide?
The canonical SMILES for N-ethyl-N-(3,4,5-trimethoxyphenyl)prop-2-enamide is C=CC(=O)N(CC)c1cc(OC)c(OC)c(OC)c1.
What is the InChIKey of N-ethyl-N-(3,4,5-trimethoxyphenyl)prop-2-enamide?
The InChIKey is VESGVKZURFMXDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO4/c1-6-13(16)15(7-2)10-8-11(17-3)14(19-5)12(9-10)18-4/h6,8-9H,1,7H2,2-5H3.
What are the key properties of N-ethyl-N-(3,4,5-trimethoxyphenyl)prop-2-enamide?
N-ethyl-N-(3,4,5-trimethoxyphenyl)prop-2-enamide has a molecular weight of 265.31 g/mol, XLogP of 2.25, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N-(3,4,5-trimethoxyphenyl)prop-2-enamide is sourced from PubChem (CID 175533762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).