C19H21NO5 — CID 21204736
N-(3-hydroxyphenyl)-3,4,5-trimethoxy-N-prop-2-enylbenzamide (PubChem CID 21204736) has the molecular formula C19H21NO5 and a molecular weight of 343.38 g/mol. Its IUPAC name is N-(3-hydroxyphenyl)-3,4,5-trimethoxy-N-prop-2-enylbenzamide.
| Compound Name | N-(3-hydroxyphenyl)-3,4,5-trimethoxy-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 21204736 |
| Molecular Formula | C19H21NO5 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | N-(3-hydroxyphenyl)-3,4,5-trimethoxy-N-prop-2-enylbenzamide |
| SMILES | C=CCN(C(=O)c1cc(OC)c(OC)c(OC)c1)c1cccc(O)c1 |
| InChI | InChI=1S/C19H21NO5/c1-5-9-20(14-7-6-8-15(21)12-14)19(22)13-10-16(23-2)18(25-4)17(11-13)24-3/h5-8,10-12,21H,1,9H2,2-4H3 |
| InChIKey | XKNMFDAWJWRJDC-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|