C19H26N2O5 — CID 110280309
N-[1-[bis(prop-2-enyl)amino]-1-oxopropan-2-yl]-3,4,5-trimethoxybenzamide (PubChem CID 110280309) has the molecular formula C19H26N2O5 and a molecular weight of 362.43 g/mol. Its IUPAC name is N-[1-[bis(prop-2-enyl)amino]-1-oxopropan-2-yl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[1-[bis(prop-2-enyl)amino]-1-oxopropan-2-yl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 110280309 |
| Molecular Formula | C19H26N2O5 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | N-[1-[bis(prop-2-enyl)amino]-1-oxopropan-2-yl]-3,4,5-trimethoxybenzamide |
| SMILES | C=CCN(CC=C)C(=O)C(C)NC(=O)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C19H26N2O5/c1-7-9-21(10-8-2)19(23)13(3)20-18(22)14-11-15(24-4)17(26-6)16(12-14)25-5/h7-8,11-13H,1-2,9-10H2,3-6H3,(H,20,22) |
| InChIKey | NTBBUGKCVKQJCY-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|