C21H26N2O3 — CID 110280231
N-[1-[bis(prop-2-enyl)amino]-1-oxopropan-2-yl]-3,5,6-trimethyl-1-benzofuran-2-carboxamide (PubChem CID 110280231) has the molecular formula C21H26N2O3 and a molecular weight of 354.45 g/mol. Its IUPAC name is N-[1-[bis(prop-2-enyl)amino]-1-oxopropan-2-yl]-3,5,6-trimethyl-1-benzofuran-2-carboxamide.
| Compound Name | N-[1-[bis(prop-2-enyl)amino]-1-oxopropan-2-yl]-3,5,6-trimethyl-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 110280231 |
| Molecular Formula | C21H26N2O3 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | N-[1-[bis(prop-2-enyl)amino]-1-oxopropan-2-yl]-3,5,6-trimethyl-1-benzofuran-2-carboxamide |
| SMILES | C=CCN(CC=C)C(=O)C(C)NC(=O)c1oc2cc(C)c(C)cc2c1C |
| InChI | InChI=1S/C21H26N2O3/c1-7-9-23(10-8-2)21(25)16(6)22-20(24)19-15(5)17-11-13(3)14(4)12-18(17)26-19/h7-8,11-12,16H,1-2,9-10H2,3-6H3,(H,22,24) |
| InChIKey | ZMBHRPCSKSLICA-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|