C20H23ClN2O3 — CID 110280223
N-[1-[bis(prop-2-enyl)amino]-1-oxopropan-2-yl]-5-chloro-3,6-dimethyl-1-benzofuran-2-carboxamide (PubChem CID 110280223) has the molecular formula C20H23ClN2O3 and a molecular weight of 374.87 g/mol. Its IUPAC name is N-[1-[bis(prop-2-enyl)amino]-1-oxopropan-2-yl]-5-chloro-3,6-dimethyl-1-benzofuran-2-carboxamide.
| Compound Name | N-[1-[bis(prop-2-enyl)amino]-1-oxopropan-2-yl]-5-chloro-3,6-dimethyl-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 110280223 |
| Molecular Formula | C20H23ClN2O3 |
| Molecular Weight | 374.87 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | N-[1-[bis(prop-2-enyl)amino]-1-oxopropan-2-yl]-5-chloro-3,6-dimethyl-1-benzofuran-2-carboxamide |
| SMILES | C=CCN(CC=C)C(=O)C(C)NC(=O)c1oc2cc(C)c(Cl)cc2c1C |
| InChI | InChI=1S/C20H23ClN2O3/c1-6-8-23(9-7-2)20(25)14(5)22-19(24)18-13(4)15-11-16(21)12(3)10-17(15)26-18/h6-7,10-11,14H,1-2,8-9H2,3-5H3,(H,22,24) |
| InChIKey | HCPRIYHJZBHMLE-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.87 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|