About 5-chloro-N-(3,3-dimethyl-2-oxobutyl)-3,6-dimethyl-1-benzofuran-2-carboxamide
5-chloro-N-(3,3-dimethyl-2-oxobutyl)-3,6-dimethyl-1-benzofuran-2-carboxamide (PubChem CID 95753622) has the molecular formula C17H20ClNO3
and a molecular weight of 321.80 g/mol. Its IUPAC name is 5-chloro-N-(3,3-dimethyl-2-oxobutyl)-3,6-dimethyl-1-benzofuran-2-carboxamide.
Molecular Properties
| Compound Name | 5-chloro-N-(3,3-dimethyl-2-oxobutyl)-3,6-dimethyl-1-benzofuran-2-carboxamide |
| PubChem CID | 95753622 |
| Molecular Formula | C17H20ClNO3 |
| Molecular Weight | 321.80 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | 5-chloro-N-(3,3-dimethyl-2-oxobutyl)-3,6-dimethyl-1-benzofuran-2-carboxamide |
| SMILES | Cc1cc2oc(C(=O)NCC(=O)C(C)(C)C)c(C)c2cc1Cl |
| InChI | InChI=1S/C17H20ClNO3/c1-9-6-13-11(7-12(9)18)10(2)15(22-13)16(21)19-8-14(20)17(3,4)5/h6-7H,8H2,1-5H3,(H,19,21) |
| InChIKey | BCJBGYMIGFDUBW-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.80 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-chloro-N-(3,3-dimethyl-2-oxobutyl)-3,6-dimethyl-1-benzofuran-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-N-(3,3-dimethyl-2-oxobutyl)-3,6-dimethyl-1-benzofuran-2-carboxamide?
The IUPAC name of 5-chloro-N-(3,3-dimethyl-2-oxobutyl)-3,6-dimethyl-1-benzofuran-2-carboxamide (CID 95753622) is 5-chloro-N-(3,3-dimethyl-2-oxobutyl)-3,6-dimethyl-1-benzofuran-2-carboxamide.
What is the SMILES notation for 5-chloro-N-(3,3-dimethyl-2-oxobutyl)-3,6-dimethyl-1-benzofuran-2-carboxamide?
The canonical SMILES for 5-chloro-N-(3,3-dimethyl-2-oxobutyl)-3,6-dimethyl-1-benzofuran-2-carboxamide is Cc1cc2oc(C(=O)NCC(=O)C(C)(C)C)c(C)c2cc1Cl.
What is the InChIKey of 5-chloro-N-(3,3-dimethyl-2-oxobutyl)-3,6-dimethyl-1-benzofuran-2-carboxamide?
The InChIKey is BCJBGYMIGFDUBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20ClNO3/c1-9-6-13-11(7-12(9)18)10(2)15(22-13)16(21)19-8-14(20)17(3,4)5/h6-7H,8H2,1-5H3,(H,19,21).
What are the key properties of 5-chloro-N-(3,3-dimethyl-2-oxobutyl)-3,6-dimethyl-1-benzofuran-2-carboxamide?
5-chloro-N-(3,3-dimethyl-2-oxobutyl)-3,6-dimethyl-1-benzofuran-2-carboxamide has a molecular weight of 321.80 g/mol, XLogP of 4.05, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-N-(3,3-dimethyl-2-oxobutyl)-3,6-dimethyl-1-benzofuran-2-carboxamide is sourced from PubChem (CID 95753622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).