C16H18ClFN2O2 — CID 110280328
N-[1-[bis(prop-2-enyl)amino]-1-oxopropan-2-yl]-2-chloro-6-fluorobenzamide (PubChem CID 110280328) has the molecular formula C16H18ClFN2O2 and a molecular weight of 324.78 g/mol. Its IUPAC name is N-[1-[bis(prop-2-enyl)amino]-1-oxopropan-2-yl]-2-chloro-6-fluorobenzamide.
| Compound Name | N-[1-[bis(prop-2-enyl)amino]-1-oxopropan-2-yl]-2-chloro-6-fluorobenzamide |
|---|---|
| PubChem CID | 110280328 |
| Molecular Formula | C16H18ClFN2O2 |
| Molecular Weight | 324.78 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | N-[1-[bis(prop-2-enyl)amino]-1-oxopropan-2-yl]-2-chloro-6-fluorobenzamide |
| SMILES | C=CCN(CC=C)C(=O)C(C)NC(=O)c1c(F)cccc1Cl |
| InChI | InChI=1S/C16H18ClFN2O2/c1-4-9-20(10-5-2)16(22)11(3)19-15(21)14-12(17)7-6-8-13(14)18/h4-8,11H,1-2,9-10H2,3H3,(H,19,21) |
| InChIKey | PEBCOAXCBRKHNY-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.78 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|