C24H24N2O4S — CID 43052353
3-[(4-methoxyphenyl)-methylsulfamoyl]-N-phenyl-N-prop-2-enylbenzamide (PubChem CID 43052353) has the molecular formula C24H24N2O4S and a molecular weight of 436.53 g/mol. Its IUPAC name is 3-[(4-methoxyphenyl)-methylsulfamoyl]-N-phenyl-N-prop-2-enylbenzamide.
| Compound Name | 3-[(4-methoxyphenyl)-methylsulfamoyl]-N-phenyl-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 43052353 |
| Molecular Formula | C24H24N2O4S |
| Molecular Weight | 436.53 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | 3-[(4-methoxyphenyl)-methylsulfamoyl]-N-phenyl-N-prop-2-enylbenzamide |
| SMILES | C=CCN(C(=O)c1cccc(S(=O)(=O)N(C)c2ccc(OC)cc2)c1)c1ccccc1 |
| InChI | InChI=1S/C24H24N2O4S/c1-4-17-26(21-10-6-5-7-11-21)24(27)19-9-8-12-23(18-19)31(28,29)25(2)20-13-15-22(30-3)16-14-20/h4-16,18H,1,17H2,2-3H3 |
| InChIKey | QTPMWPICEVGFTG-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.53 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|