C17H23N3O4 — CID 166424579
5-(oxan-4-yl)-N-[1-(1-prop-2-enoylazetidin-3-yl)ethyl]-1,2-oxazole-3-carboxamide (PubChem CID 166424579) has the molecular formula C17H23N3O4 and a molecular weight of 333.39 g/mol. Its IUPAC name is 5-(oxan-4-yl)-N-[1-(1-prop-2-enoylazetidin-3-yl)ethyl]-1,2-oxazole-3-carboxamide.
| Compound Name | 5-(oxan-4-yl)-N-[1-(1-prop-2-enoylazetidin-3-yl)ethyl]-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 166424579 |
| Molecular Formula | C17H23N3O4 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | 5-(oxan-4-yl)-N-[1-(1-prop-2-enoylazetidin-3-yl)ethyl]-1,2-oxazole-3-carboxamide |
| SMILES | C=CC(=O)N1CC(C(C)NC(=O)c2cc(C3CCOCC3)on2)C1 |
| InChI | InChI=1S/C17H23N3O4/c1-3-16(21)20-9-13(10-20)11(2)18-17(22)14-8-15(24-19-14)12-4-6-23-7-5-12/h3,8,11-13H,1,4-7,9-10H2,2H3,(H,18,22) |
| InChIKey | LYAFVNLHLFHUAP-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 84.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|