C19H25FN2O3 — CID 166424601
5-fluoro-2-propan-2-yloxy-N-[1-(1-prop-2-enoylazetidin-3-yl)propan-2-yl]benzamide (PubChem CID 166424601) has the molecular formula C19H25FN2O3 and a molecular weight of 348.42 g/mol. Its IUPAC name is 5-fluoro-2-propan-2-yloxy-N-[1-(1-prop-2-enoylazetidin-3-yl)propan-2-yl]benzamide.
| Compound Name | 5-fluoro-2-propan-2-yloxy-N-[1-(1-prop-2-enoylazetidin-3-yl)propan-2-yl]benzamide |
|---|---|
| PubChem CID | 166424601 |
| Molecular Formula | C19H25FN2O3 |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | 5-fluoro-2-propan-2-yloxy-N-[1-(1-prop-2-enoylazetidin-3-yl)propan-2-yl]benzamide |
| SMILES | C=CC(=O)N1CC(CC(C)NC(=O)c2cc(F)ccc2OC(C)C)C1 |
| InChI | InChI=1S/C19H25FN2O3/c1-5-18(23)22-10-14(11-22)8-13(4)21-19(24)16-9-15(20)6-7-17(16)25-12(2)3/h5-7,9,12-14H,1,8,10-11H2,2-4H3,(H,21,24) |
| InChIKey | NXQAXGUMGFMPJY-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|