C21H20N4O7S — CID 166426639
2-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]oxy]-N-(3-sulfamoylphenyl)acetamide (PubChem CID 166426639) has the molecular formula C21H20N4O7S and a molecular weight of 472.48 g/mol. Its IUPAC name is 2-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]oxy]-N-(3-sulfamoylphenyl)acetamide.
| Compound Name | 2-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]oxy]-N-(3-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 166426639 |
| Molecular Formula | C21H20N4O7S |
| Molecular Weight | 472.48 g/mol |
| Exact Mass | 472.11 |
| IUPAC Name | 2-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]oxy]-N-(3-sulfamoylphenyl)acetamide |
| SMILES | NS(=O)(=O)c1cccc(NC(=O)COc2ccc3c(c2)CN(C2CCC(=O)NC2=O)C3=O)c1 |
| InChI | InChI=1S/C21H20N4O7S/c22-33(30,31)15-3-1-2-13(9-15)23-19(27)11-32-14-4-5-16-12(8-14)10-25(21(16)29)17-6-7-18(26)24-20(17)28/h1-5,8-9,17H,6-7,10-11H2,(H,23,27)(H2,22,30,31)(H,24,26,28) |
| InChIKey | QXTKKCDNKRWOKZ-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 164.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.48 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|