C23H17F6N3O2S — CID 166427289
N-[5-[[3,5-bis(trifluoromethyl)phenyl]methyl]-1,3-thiazol-2-yl]-2-[(prop-2-enoylamino)methyl]benzamide (PubChem CID 166427289) has the molecular formula C23H17F6N3O2S and a molecular weight of 513.46 g/mol. Its IUPAC name is N-[5-[[3,5-bis(trifluoromethyl)phenyl]methyl]-1,3-thiazol-2-yl]-2-[(prop-2-enoylamino)methyl]benzamide.
| Compound Name | N-[5-[[3,5-bis(trifluoromethyl)phenyl]methyl]-1,3-thiazol-2-yl]-2-[(prop-2-enoylamino)methyl]benzamide |
|---|---|
| PubChem CID | 166427289 |
| Molecular Formula | C23H17F6N3O2S |
| Molecular Weight | 513.46 g/mol |
| Exact Mass | 513.09 |
| IUPAC Name | N-[5-[[3,5-bis(trifluoromethyl)phenyl]methyl]-1,3-thiazol-2-yl]-2-[(prop-2-enoylamino)methyl]benzamide |
| SMILES | C=CC(=O)NCc1ccccc1C(=O)Nc1ncc(Cc2cc(C(F)(F)F)cc(C(F)(F)F)c2)s1 |
| InChI | InChI=1S/C23H17F6N3O2S/c1-2-19(33)30-11-14-5-3-4-6-18(14)20(34)32-21-31-12-17(35-21)9-13-7-15(22(24,25)26)10-16(8-13)23(27,28)29/h2-8,10,12H,1,9,11H2,(H,30,33)(H,31,32,34) |
| InChIKey | UBCKGLVJXNWZEZ-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.46 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|