C14H16BN3O4 — CID 166428730
[2-formyl-3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethoxy)phenyl]boronic acid (PubChem CID 166428730) has the molecular formula C14H16BN3O4 and a molecular weight of 301.11 g/mol. Its IUPAC name is [2-formyl-3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethoxy)phenyl]boronic acid.
| Compound Name | [2-formyl-3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethoxy)phenyl]boronic acid |
|---|---|
| PubChem CID | 166428730 |
| Molecular Formula | C14H16BN3O4 |
| Molecular Weight | 301.11 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | [2-formyl-3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethoxy)phenyl]boronic acid |
| SMILES | O=Cc1c(OCc2nnc3n2CCCC3)cccc1B(O)O |
| InChI | InChI=1S/C14H16BN3O4/c19-8-10-11(15(20)21)4-3-5-12(10)22-9-14-17-16-13-6-1-2-7-18(13)14/h3-5,8,20-21H,1-2,6-7,9H2 |
| InChIKey | OOHAZGORPDVGCJ-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 97.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.11 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|