C14H13FN4O — CID 103849655
2-fluoro-6-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethoxy)benzonitrile (PubChem CID 103849655) has the molecular formula C14H13FN4O and a molecular weight of 272.28 g/mol. Its IUPAC name is 2-fluoro-6-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethoxy)benzonitrile.
| Compound Name | 2-fluoro-6-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethoxy)benzonitrile |
|---|---|
| PubChem CID | 103849655 |
| Molecular Formula | C14H13FN4O |
| Molecular Weight | 272.28 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | 2-fluoro-6-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethoxy)benzonitrile |
| SMILES | N#Cc1c(F)cccc1OCc1nnc2n1CCCC2 |
| InChI | InChI=1S/C14H13FN4O/c15-11-4-3-5-12(10(11)8-16)20-9-14-18-17-13-6-1-2-7-19(13)14/h3-5H,1-2,6-7,9H2 |
| InChIKey | PZDHBQQBCWDPGX-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 63.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.28 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |