C18H26ClN3O — CID 166429844
N-[[1-(4-chlorophenyl)pyrrolidin-2-yl]methyl]-4-methylpiperidine-1-carboxamide (PubChem CID 166429844) has the molecular formula C18H26ClN3O and a molecular weight of 335.88 g/mol. Its IUPAC name is N-[[1-(4-chlorophenyl)pyrrolidin-2-yl]methyl]-4-methylpiperidine-1-carboxamide.
| Compound Name | N-[[1-(4-chlorophenyl)pyrrolidin-2-yl]methyl]-4-methylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 166429844 |
| Molecular Formula | C18H26ClN3O |
| Molecular Weight | 335.88 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | N-[[1-(4-chlorophenyl)pyrrolidin-2-yl]methyl]-4-methylpiperidine-1-carboxamide |
| SMILES | CC1CCN(C(=O)NCC2CCCN2c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C18H26ClN3O/c1-14-8-11-21(12-9-14)18(23)20-13-17-3-2-10-22(17)16-6-4-15(19)5-7-16/h4-7,14,17H,2-3,8-13H2,1H3,(H,20,23) |
| InChIKey | FWBRVMLJACGKIF-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.88 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |