C17H25ClN4O — CID 166430138
N-[[1-(6-chloro-3-pyridinyl)pyrrolidin-3-yl]methyl]-4-methylpiperidine-1-carboxamide (PubChem CID 166430138) has the molecular formula C17H25ClN4O and a molecular weight of 336.87 g/mol. Its IUPAC name is N-[[1-(6-chloro-3-pyridinyl)pyrrolidin-3-yl]methyl]-4-methylpiperidine-1-carboxamide.
| Compound Name | N-[[1-(6-chloro-3-pyridinyl)pyrrolidin-3-yl]methyl]-4-methylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 166430138 |
| Molecular Formula | C17H25ClN4O |
| Molecular Weight | 336.87 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | N-[[1-(6-chloro-3-pyridinyl)pyrrolidin-3-yl]methyl]-4-methylpiperidine-1-carboxamide |
| SMILES | CC1CCN(C(=O)NCC2CCN(c3ccc(Cl)nc3)C2)CC1 |
| InChI | InChI=1S/C17H25ClN4O/c1-13-4-7-21(8-5-13)17(23)20-10-14-6-9-22(12-14)15-2-3-16(18)19-11-15/h2-3,11,13-14H,4-10,12H2,1H3,(H,20,23) |
| InChIKey | GJFMECNGZYFAGP-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.87 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|