C18H23N7O — CID 166430013
N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-5-(2-ethylimidazol-1-yl)-1,3-dimethylpyrazole-4-carboxamide (PubChem CID 166430013) has the molecular formula C18H23N7O and a molecular weight of 353.43 g/mol. Its IUPAC name is N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-5-(2-ethylimidazol-1-yl)-1,3-dimethylpyrazole-4-carboxamide.
| Compound Name | N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-5-(2-ethylimidazol-1-yl)-1,3-dimethylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 166430013 |
| Molecular Formula | C18H23N7O |
| Molecular Weight | 353.43 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-5-(2-ethylimidazol-1-yl)-1,3-dimethylpyrazole-4-carboxamide |
| SMILES | C#CCCC1(CCNC(=O)c2c(C)nn(C)c2-n2ccnc2CC)N=N1 |
| InChI | InChI=1S/C18H23N7O/c1-5-7-8-18(22-23-18)9-10-20-16(26)15-13(3)21-24(4)17(15)25-12-11-19-14(25)6-2/h1,11-12H,6-10H2,2-4H3,(H,20,26) |
| InChIKey | OIGYOZSDWZYGGL-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 89.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.43 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|