C15H14BClN2O4 — CID 166430851
[4-[1-(3-chloro-2-pyridinyl)ethylcarbamoyl]-2-formylphenyl]boronic acid (PubChem CID 166430851) has the molecular formula C15H14BClN2O4 and a molecular weight of 332.55 g/mol. Its IUPAC name is [4-[1-(3-chloro-2-pyridinyl)ethylcarbamoyl]-2-formylphenyl]boronic acid.
| Compound Name | [4-[1-(3-chloro-2-pyridinyl)ethylcarbamoyl]-2-formylphenyl]boronic acid |
|---|---|
| PubChem CID | 166430851 |
| Molecular Formula | C15H14BClN2O4 |
| Molecular Weight | 332.55 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | [4-[1-(3-chloro-2-pyridinyl)ethylcarbamoyl]-2-formylphenyl]boronic acid |
| SMILES | CC(NC(=O)c1ccc(B(O)O)c(C=O)c1)c1ncccc1Cl |
| InChI | InChI=1S/C15H14BClN2O4/c1-9(14-13(17)3-2-6-18-14)19-15(21)10-4-5-12(16(22)23)11(7-10)8-20/h2-9,22-23H,1H3,(H,19,21) |
| InChIKey | PPENVJRYEYFAFF-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.55 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|