C17H19BNO5P — CID 166432514
[4-[[dimethylphosphoryl(phenyl)methyl]carbamoyl]-2-formylphenyl]boronic acid (PubChem CID 166432514) has the molecular formula C17H19BNO5P and a molecular weight of 359.13 g/mol. Its IUPAC name is [4-[[dimethylphosphoryl(phenyl)methyl]carbamoyl]-2-formylphenyl]boronic acid.
| Compound Name | [4-[[dimethylphosphoryl(phenyl)methyl]carbamoyl]-2-formylphenyl]boronic acid |
|---|---|
| PubChem CID | 166432514 |
| Molecular Formula | C17H19BNO5P |
| Molecular Weight | 359.13 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | [4-[[dimethylphosphoryl(phenyl)methyl]carbamoyl]-2-formylphenyl]boronic acid |
| SMILES | CP(C)(=O)C(NC(=O)c1ccc(B(O)O)c(C=O)c1)c1ccccc1 |
| InChI | InChI=1S/C17H19BNO5P/c1-25(2,24)17(12-6-4-3-5-7-12)19-16(21)13-8-9-15(18(22)23)14(10-13)11-20/h3-11,17,22-23H,1-2H3,(H,19,21) |
| InChIKey | KDRMUKPHAXOION-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.13 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|