C15H13NO4 — CID 23038061
3,4-dihydroxy-N-(2-oxo-1-phenylethyl)benzamide (PubChem CID 23038061) has the molecular formula C15H13NO4 and a molecular weight of 271.27 g/mol. Its IUPAC name is 3,4-dihydroxy-N-(2-oxo-1-phenylethyl)benzamide.
| Compound Name | 3,4-dihydroxy-N-(2-oxo-1-phenylethyl)benzamide |
|---|---|
| PubChem CID | 23038061 |
| Molecular Formula | C15H13NO4 |
| Molecular Weight | 271.27 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 3,4-dihydroxy-N-(2-oxo-1-phenylethyl)benzamide |
| SMILES | O=CC(NC(=O)c1ccc(O)c(O)c1)c1ccccc1 |
| InChI | InChI=1S/C15H13NO4/c17-9-12(10-4-2-1-3-5-10)16-15(20)11-6-7-13(18)14(19)8-11/h1-9,12,18-19H,(H,16,20) |
| InChIKey | DIGTYCLORIDJND-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.27 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|