C11H15NO4 — CID 144634454
methanol;methyl N-[(1S)-2-oxo-1-phenylethyl]carbamate (PubChem CID 144634454) has the molecular formula C11H15NO4 and a molecular weight of 225.24 g/mol. Its IUPAC name is methanol;methyl N-[(1S)-2-oxo-1-phenylethyl]carbamate.
| Compound Name | methanol;methyl N-[(1S)-2-oxo-1-phenylethyl]carbamate |
|---|---|
| PubChem CID | 144634454 |
| Molecular Formula | C11H15NO4 |
| Molecular Weight | 225.24 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | methanol;methyl N-[(1S)-2-oxo-1-phenylethyl]carbamate |
| SMILES | CO.COC(=O)N[C@H](C=O)c1ccccc1 |
| InChI | InChI=1S/C10H11NO3.CH4O/c1-14-10(13)11-9(7-12)8-5-3-2-4-6-8;1-2/h2-7,9H,1H3,(H,11,13);2H,1H3/t9-;/m1./s1 |
| InChIKey | NXNQIESYKOCKHV-SBSPUUFOSA-N |
| XLogP | 0.89 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.24 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|