About methanol;methoxymethane;N-(2-oxo-1-phenylethyl)formamide
methanol;methoxymethane;N-(2-oxo-1-phenylethyl)formamide (PubChem CID 155715793) has the molecular formula C12H19NO4
and a molecular weight of 241.29 g/mol. Its IUPAC name is methanol;methoxymethane;N-(2-oxo-1-phenylethyl)formamide.
Molecular Properties
| Compound Name | methanol;methoxymethane;N-(2-oxo-1-phenylethyl)formamide |
| PubChem CID | 155715793 |
| Molecular Formula | C12H19NO4 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | methanol;methoxymethane;N-(2-oxo-1-phenylethyl)formamide |
| SMILES | CO.COC.O=CNC(C=O)c1ccccc1 |
| InChI | InChI=1S/C9H9NO2.C2H6O.CH4O/c11-6-9(10-7-12)8-4-2-1-3-5-8;1-3-2;1-2/h1-7,9H,(H,10,12);1-2H3;2H,1H3 |
| InChIKey | JIRKVCWEPHVRHC-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze methanol;methoxymethane;N-(2-oxo-1-phenylethyl)formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanol;methoxymethane;N-(2-oxo-1-phenylethyl)formamide?
The IUPAC name of methanol;methoxymethane;N-(2-oxo-1-phenylethyl)formamide (CID 155715793) is methanol;methoxymethane;N-(2-oxo-1-phenylethyl)formamide.
What is the SMILES notation for methanol;methoxymethane;N-(2-oxo-1-phenylethyl)formamide?
The canonical SMILES for methanol;methoxymethane;N-(2-oxo-1-phenylethyl)formamide is CO.COC.O=CNC(C=O)c1ccccc1.
What is the InChIKey of methanol;methoxymethane;N-(2-oxo-1-phenylethyl)formamide?
The InChIKey is JIRKVCWEPHVRHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO2.C2H6O.CH4O/c11-6-9(10-7-12)8-4-2-1-3-5-8;1-3-2;1-2/h1-7,9H,(H,10,12);1-2H3;2H,1H3.
What are the key properties of methanol;methoxymethane;N-(2-oxo-1-phenylethyl)formamide?
methanol;methoxymethane;N-(2-oxo-1-phenylethyl)formamide has a molecular weight of 241.29 g/mol, XLogP of 0.54, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methanol;methoxymethane;N-(2-oxo-1-phenylethyl)formamide is sourced from PubChem (CID 155715793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).