C13H18BNO5 — CID 166430542
[2-formyl-4-(1-methoxybutan-2-ylcarbamoyl)phenyl]boronic acid (PubChem CID 166430542) has the molecular formula C13H18BNO5 and a molecular weight of 279.10 g/mol. Its IUPAC name is [2-formyl-4-(1-methoxybutan-2-ylcarbamoyl)phenyl]boronic acid.
| Compound Name | [2-formyl-4-(1-methoxybutan-2-ylcarbamoyl)phenyl]boronic acid |
|---|---|
| PubChem CID | 166430542 |
| Molecular Formula | C13H18BNO5 |
| Molecular Weight | 279.10 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | [2-formyl-4-(1-methoxybutan-2-ylcarbamoyl)phenyl]boronic acid |
| SMILES | CCC(COC)NC(=O)c1ccc(B(O)O)c(C=O)c1 |
| InChI | InChI=1S/C13H18BNO5/c1-3-11(8-20-2)15-13(17)9-4-5-12(14(18)19)10(6-9)7-16/h4-7,11,18-19H,3,8H2,1-2H3,(H,15,17) |
| InChIKey | IIGISDABNTYLTB-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.10 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|