C13H18BNO5 — CID 166431191
[4-[[(2S,4R)-4-hydroxy-2-methoxycarbonylpyrrolidin-1-yl]methyl]phenyl]boronic acid (PubChem CID 166431191) has the molecular formula C13H18BNO5 and a molecular weight of 279.10 g/mol. Its IUPAC name is [4-[[(2S,4R)-4-hydroxy-2-methoxycarbonylpyrrolidin-1-yl]methyl]phenyl]boronic acid.
| Compound Name | [4-[[(2S,4R)-4-hydroxy-2-methoxycarbonylpyrrolidin-1-yl]methyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 166431191 |
| Molecular Formula | C13H18BNO5 |
| Molecular Weight | 279.10 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | [4-[[(2S,4R)-4-hydroxy-2-methoxycarbonylpyrrolidin-1-yl]methyl]phenyl]boronic acid |
| SMILES | COC(=O)[C@@H]1C[C@@H](O)CN1Cc1ccc(B(O)O)cc1 |
| InChI | InChI=1S/C13H18BNO5/c1-20-13(17)12-6-11(16)8-15(12)7-9-2-4-10(5-3-9)14(18)19/h2-5,11-12,16,18-19H,6-8H2,1H3/t11-,12+/m1/s1 |
| InChIKey | NLQSDERKZJNJLQ-NEPJUHHUSA-N |
| XLogP | -1.53 |
| TPSA | 90.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.10 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|