C14H17Cl2NO4 — CID 166432113
2-chloro-N-[(5-chloro-2-methoxyphenyl)methyl]-N-[(3S,4R)-4-hydroxyoxolan-3-yl]acetamide (PubChem CID 166432113) has the molecular formula C14H17Cl2NO4 and a molecular weight of 334.20 g/mol. Its IUPAC name is 2-chloro-N-[(5-chloro-2-methoxyphenyl)methyl]-N-[(3S,4R)-4-hydroxyoxolan-3-yl]acetamide.
| Compound Name | 2-chloro-N-[(5-chloro-2-methoxyphenyl)methyl]-N-[(3S,4R)-4-hydroxyoxolan-3-yl]acetamide |
|---|---|
| PubChem CID | 166432113 |
| Molecular Formula | C14H17Cl2NO4 |
| Molecular Weight | 334.20 g/mol |
| Exact Mass | 333.05 |
| IUPAC Name | 2-chloro-N-[(5-chloro-2-methoxyphenyl)methyl]-N-[(3S,4R)-4-hydroxyoxolan-3-yl]acetamide |
| SMILES | COc1ccc(Cl)cc1CN(C(=O)CCl)[C@H]1COC[C@@H]1O |
| InChI | InChI=1S/C14H17Cl2NO4/c1-20-13-3-2-10(16)4-9(13)6-17(14(19)5-15)11-7-21-8-12(11)18/h2-4,11-12,18H,5-8H2,1H3/t11-,12-/m0/s1 |
| InChIKey | JUKARLLAXDUOAZ-RYUDHWBXSA-N |
| XLogP | 1.68 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.20 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|