C12H12Cl3NO — CID 66568175
2-chloro-N-cyclopropyl-N-[(2,5-dichlorophenyl)methyl]acetamide (PubChem CID 66568175) has the molecular formula C12H12Cl3NO and a molecular weight of 292.59 g/mol. Its IUPAC name is 2-chloro-N-cyclopropyl-N-[(2,5-dichlorophenyl)methyl]acetamide.
| Compound Name | 2-chloro-N-cyclopropyl-N-[(2,5-dichlorophenyl)methyl]acetamide |
|---|---|
| PubChem CID | 66568175 |
| Molecular Formula | C12H12Cl3NO |
| Molecular Weight | 292.59 g/mol |
| Exact Mass | 291.00 |
| IUPAC Name | 2-chloro-N-cyclopropyl-N-[(2,5-dichlorophenyl)methyl]acetamide |
| SMILES | O=C(CCl)N(Cc1cc(Cl)ccc1Cl)C1CC1 |
| InChI | InChI=1S/C12H12Cl3NO/c13-6-12(17)16(10-2-3-10)7-8-5-9(14)1-4-11(8)15/h1,4-5,10H,2-3,6-7H2 |
| InChIKey | QCZSRZQCVYWOKP-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.59 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|