C20H20Cl2N2O2 — CID 46579429
4-[[cyclopropyl-[3-(2,4-dichlorophenyl)propanoyl]amino]methyl]benzamide (PubChem CID 46579429) has the molecular formula C20H20Cl2N2O2 and a molecular weight of 391.30 g/mol. Its IUPAC name is 4-[[cyclopropyl-[3-(2,4-dichlorophenyl)propanoyl]amino]methyl]benzamide.
| Compound Name | 4-[[cyclopropyl-[3-(2,4-dichlorophenyl)propanoyl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 46579429 |
| Molecular Formula | C20H20Cl2N2O2 |
| Molecular Weight | 391.30 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | 4-[[cyclopropyl-[3-(2,4-dichlorophenyl)propanoyl]amino]methyl]benzamide |
| SMILES | NC(=O)c1ccc(CN(C(=O)CCc2ccc(Cl)cc2Cl)C2CC2)cc1 |
| InChI | InChI=1S/C20H20Cl2N2O2/c21-16-7-5-14(18(22)11-16)6-10-19(25)24(17-8-9-17)12-13-1-3-15(4-2-13)20(23)26/h1-5,7,11,17H,6,8-10,12H2,(H2,23,26) |
| InChIKey | DSUBPFAGABWTSI-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.30 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |