C23H22BN3O4 — CID 166432569
[4-[[6-(3,4-dihydro-2H-quinolin-1-yl)-3-pyridinyl]methylcarbamoyl]-2-formylphenyl]boronic acid (PubChem CID 166432569) has the molecular formula C23H22BN3O4 and a molecular weight of 415.26 g/mol. Its IUPAC name is [4-[[6-(3,4-dihydro-2H-quinolin-1-yl)-3-pyridinyl]methylcarbamoyl]-2-formylphenyl]boronic acid.
| Compound Name | [4-[[6-(3,4-dihydro-2H-quinolin-1-yl)-3-pyridinyl]methylcarbamoyl]-2-formylphenyl]boronic acid |
|---|---|
| PubChem CID | 166432569 |
| Molecular Formula | C23H22BN3O4 |
| Molecular Weight | 415.26 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | [4-[[6-(3,4-dihydro-2H-quinolin-1-yl)-3-pyridinyl]methylcarbamoyl]-2-formylphenyl]boronic acid |
| SMILES | O=Cc1cc(C(=O)NCc2ccc(N3CCCc4ccccc43)nc2)ccc1B(O)O |
| InChI | InChI=1S/C23H22BN3O4/c28-15-19-12-18(8-9-20(19)24(30)31)23(29)26-14-16-7-10-22(25-13-16)27-11-3-5-17-4-1-2-6-21(17)27/h1-2,4,6-10,12-13,15,30-31H,3,5,11,14H2,(H,26,29) |
| InChIKey | MXABXGYAYHCUAH-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 102.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.26 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|