C22H33N3O3 — CID 166433967
2-[2-(3-cyclohexyl-5-methyl-1,2-oxazole-4-carbonyl)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-6-yl]acetamide (PubChem CID 166433967) has the molecular formula C22H33N3O3 and a molecular weight of 387.52 g/mol. Its IUPAC name is 2-[2-(3-cyclohexyl-5-methyl-1,2-oxazole-4-carbonyl)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-6-yl]acetamide.
| Compound Name | 2-[2-(3-cyclohexyl-5-methyl-1,2-oxazole-4-carbonyl)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-6-yl]acetamide |
|---|---|
| PubChem CID | 166433967 |
| Molecular Formula | C22H33N3O3 |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.25 |
| IUPAC Name | 2-[2-(3-cyclohexyl-5-methyl-1,2-oxazole-4-carbonyl)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-6-yl]acetamide |
| SMILES | Cc1onc(C2CCCCC2)c1C(=O)N1CCC2CC(CC(N)=O)CCC2C1 |
| InChI | InChI=1S/C22H33N3O3/c1-14-20(21(24-28-14)16-5-3-2-4-6-16)22(27)25-10-9-17-11-15(12-19(23)26)7-8-18(17)13-25/h15-18H,2-13H2,1H3,(H2,23,26) |
| InChIKey | YAWPMSSRPWLEQK-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 89.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |