C18H22N2O2 — CID 90608578
(3,5-dimethyl-1,2-oxazol-4-yl)-(3-phenylazepan-1-yl)methanone (PubChem CID 90608578) has the molecular formula C18H22N2O2 and a molecular weight of 298.39 g/mol. Its IUPAC name is (3,5-dimethyl-1,2-oxazol-4-yl)-(3-phenylazepan-1-yl)methanone.
| Compound Name | (3,5-dimethyl-1,2-oxazol-4-yl)-(3-phenylazepan-1-yl)methanone |
|---|---|
| PubChem CID | 90608578 |
| Molecular Formula | C18H22N2O2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | (3,5-dimethyl-1,2-oxazol-4-yl)-(3-phenylazepan-1-yl)methanone |
| SMILES | Cc1noc(C)c1C(=O)N1CCCCC(c2ccccc2)C1 |
| InChI | InChI=1S/C18H22N2O2/c1-13-17(14(2)22-19-13)18(21)20-11-7-6-10-16(12-20)15-8-4-3-5-9-15/h3-5,8-9,16H,6-7,10-12H2,1-2H3 |
| InChIKey | MEUIABKHYRVAES-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |