C19H22N2O2 — CID 90608568
(5-cyclopropyl-1,2-oxazol-3-yl)-(3-phenylazepan-1-yl)methanone (PubChem CID 90608568) has the molecular formula C19H22N2O2 and a molecular weight of 310.40 g/mol. Its IUPAC name is (5-cyclopropyl-1,2-oxazol-3-yl)-(3-phenylazepan-1-yl)methanone.
| Compound Name | (5-cyclopropyl-1,2-oxazol-3-yl)-(3-phenylazepan-1-yl)methanone |
|---|---|
| PubChem CID | 90608568 |
| Molecular Formula | C19H22N2O2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | (5-cyclopropyl-1,2-oxazol-3-yl)-(3-phenylazepan-1-yl)methanone |
| SMILES | O=C(c1cc(C2CC2)on1)N1CCCCC(c2ccccc2)C1 |
| InChI | InChI=1S/C19H22N2O2/c22-19(17-12-18(23-20-17)15-9-10-15)21-11-5-4-8-16(13-21)14-6-2-1-3-7-14/h1-3,6-7,12,15-16H,4-5,8-11,13H2 |
| InChIKey | PAMRZPNYWBZWAR-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |