C17H22N2O3S — CID 90608649
3,5-dimethyl-4-(3-phenylazepan-1-yl)sulfonyl-1,2-oxazole (PubChem CID 90608649) has the molecular formula C17H22N2O3S and a molecular weight of 334.44 g/mol. Its IUPAC name is 3,5-dimethyl-4-(3-phenylazepan-1-yl)sulfonyl-1,2-oxazole.
| Compound Name | 3,5-dimethyl-4-(3-phenylazepan-1-yl)sulfonyl-1,2-oxazole |
|---|---|
| PubChem CID | 90608649 |
| Molecular Formula | C17H22N2O3S |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | 3,5-dimethyl-4-(3-phenylazepan-1-yl)sulfonyl-1,2-oxazole |
| SMILES | Cc1noc(C)c1S(=O)(=O)N1CCCCC(c2ccccc2)C1 |
| InChI | InChI=1S/C17H22N2O3S/c1-13-17(14(2)22-18-13)23(20,21)19-11-7-6-10-16(12-19)15-8-4-3-5-9-15/h3-5,8-9,16H,6-7,10-12H2,1-2H3 |
| InChIKey | AGSYSVDJXOURPU-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 63.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |