C18H25FN4O2 — CID 166435620
1-[[(2-fluorophenyl)-(1-methylimidazol-2-yl)methyl]amino]-3-morpholin-4-ylpropan-2-ol (PubChem CID 166435620) has the molecular formula C18H25FN4O2 and a molecular weight of 348.42 g/mol. Its IUPAC name is 1-[[(2-fluorophenyl)-(1-methylimidazol-2-yl)methyl]amino]-3-morpholin-4-ylpropan-2-ol.
| Compound Name | 1-[[(2-fluorophenyl)-(1-methylimidazol-2-yl)methyl]amino]-3-morpholin-4-ylpropan-2-ol |
|---|---|
| PubChem CID | 166435620 |
| Molecular Formula | C18H25FN4O2 |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | 1-[[(2-fluorophenyl)-(1-methylimidazol-2-yl)methyl]amino]-3-morpholin-4-ylpropan-2-ol |
| SMILES | Cn1ccnc1C(NCC(O)CN1CCOCC1)c1ccccc1F |
| InChI | InChI=1S/C18H25FN4O2/c1-22-7-6-20-18(22)17(15-4-2-3-5-16(15)19)21-12-14(24)13-23-8-10-25-11-9-23/h2-7,14,17,21,24H,8-13H2,1H3 |
| InChIKey | XAMKLEOKINUNDD-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |