C16H11F2N3O — CID 166436756
2-(2-azidophenyl)-4-(3,5-difluorophenyl)but-3-yn-2-ol (PubChem CID 166436756) has the molecular formula C16H11F2N3O and a molecular weight of 299.28 g/mol. Its IUPAC name is 2-(2-azidophenyl)-4-(3,5-difluorophenyl)but-3-yn-2-ol.
| Compound Name | 2-(2-azidophenyl)-4-(3,5-difluorophenyl)but-3-yn-2-ol |
|---|---|
| PubChem CID | 166436756 |
| Molecular Formula | C16H11F2N3O |
| Molecular Weight | 299.28 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | 2-(2-azidophenyl)-4-(3,5-difluorophenyl)but-3-yn-2-ol |
| SMILES | CC(O)(C#Cc1cc(F)cc(F)c1)c1ccccc1N=[N+]=[N-] |
| InChI | InChI=1S/C16H11F2N3O/c1-16(22,14-4-2-3-5-15(14)20-21-19)7-6-11-8-12(17)10-13(18)9-11/h2-5,8-10,22H,1H3 |
| InChIKey | ARVVNHNPPWKKOZ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 68.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.28 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|