C32H26F3NO3S — CID 166437031
trifluoromethanesulfonate;2,4,6-triphenyl-1-(1-phenylethyl)pyridin-1-ium (PubChem CID 166437031) has the molecular formula C32H26F3NO3S and a molecular weight of 561.63 g/mol. Its IUPAC name is trifluoromethanesulfonate;2,4,6-triphenyl-1-(1-phenylethyl)pyridin-1-ium.
| Compound Name | trifluoromethanesulfonate;2,4,6-triphenyl-1-(1-phenylethyl)pyridin-1-ium |
|---|---|
| PubChem CID | 166437031 |
| Molecular Formula | C32H26F3NO3S |
| Molecular Weight | 561.63 g/mol |
| Exact Mass | 561.16 |
| IUPAC Name | trifluoromethanesulfonate;2,4,6-triphenyl-1-(1-phenylethyl)pyridin-1-ium |
| SMILES | CC(c1ccccc1)[n+]1c(-c2ccccc2)cc(-c2ccccc2)cc1-c1ccccc1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C31H26N.CHF3O3S/c1-24(25-14-6-2-7-15-25)32-30(27-18-10-4-11-19-27)22-29(26-16-8-3-9-17-26)23-31(32)28-20-12-5-13-21-28;2-1(3,4)8(5,6)7/h2-24H,1H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | GIIZFCNOOGQBSG-UHFFFAOYSA-M |
| XLogP | 7.64 |
| TPSA | 61.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.63 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|