C34H23F10NO3S — CID 166437032
4-(4-fluorophenyl)-1-(1-phenylethyl)-2,6-bis[4-(trifluoromethyl)phenyl]pyridin-1-ium;trifluoromethanesulfonate (PubChem CID 166437032) has the molecular formula C34H23F10NO3S and a molecular weight of 715.61 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-1-(1-phenylethyl)-2,6-bis[4-(trifluoromethyl)phenyl]pyridin-1-ium;trifluoromethanesulfonate.
| Compound Name | 4-(4-fluorophenyl)-1-(1-phenylethyl)-2,6-bis[4-(trifluoromethyl)phenyl]pyridin-1-ium;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 166437032 |
| Molecular Formula | C34H23F10NO3S |
| Molecular Weight | 715.61 g/mol |
| Exact Mass | 715.12 |
| IUPAC Name | 4-(4-fluorophenyl)-1-(1-phenylethyl)-2,6-bis[4-(trifluoromethyl)phenyl]pyridin-1-ium;trifluoromethanesulfonate |
| SMILES | CC(c1ccccc1)[n+]1c(-c2ccc(C(F)(F)F)cc2)cc(-c2ccc(F)cc2)cc1-c1ccc(C(F)(F)F)cc1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C33H23F7N.CHF3O3S/c1-21(22-5-3-2-4-6-22)41-30(24-7-13-27(14-8-24)32(35,36)37)19-26(23-11-17-29(34)18-12-23)20-31(41)25-9-15-28(16-10-25)33(38,39)40;2-1(3,4)8(5,6)7/h2-21H,1H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | XJDGIDQSAMIRFQ-UHFFFAOYSA-M |
| XLogP | 9.81 |
| TPSA | 61.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.61 |
| LogP ≤ 5 | 9.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|