C20H21N — CID 166437264
N-benzyl-5-methyl-2-prop-2-enyl-2,3-dihydroinden-1-imine (PubChem CID 166437264) has the molecular formula C20H21N and a molecular weight of 275.39 g/mol. Its IUPAC name is N-benzyl-5-methyl-2-prop-2-enyl-2,3-dihydroinden-1-imine.
| Compound Name | N-benzyl-5-methyl-2-prop-2-enyl-2,3-dihydroinden-1-imine |
|---|---|
| PubChem CID | 166437264 |
| Molecular Formula | C20H21N |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | N-benzyl-5-methyl-2-prop-2-enyl-2,3-dihydroinden-1-imine |
| SMILES | C=CCC1Cc2cc(C)ccc2/C1=N/Cc1ccccc1 |
| InChI | InChI=1S/C20H21N/c1-3-7-17-13-18-12-15(2)10-11-19(18)20(17)21-14-16-8-5-4-6-9-16/h3-6,8-12,17H,1,7,13-14H2,2H3/b21-20+ |
| InChIKey | FKTJEEYVUUWAGH-QZQOTICOSA-N |
| XLogP | 4.73 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|