C21H15ClINO — CID 166437412
(E)-3-(4-chloro-2-iodoanilino)-1,3-diphenylprop-2-en-1-one (PubChem CID 166437412) has the molecular formula C21H15ClINO and a molecular weight of 459.71 g/mol. Its IUPAC name is (E)-3-(4-chloro-2-iodoanilino)-1,3-diphenylprop-2-en-1-one.
| Compound Name | (E)-3-(4-chloro-2-iodoanilino)-1,3-diphenylprop-2-en-1-one |
|---|---|
| PubChem CID | 166437412 |
| Molecular Formula | C21H15ClINO |
| Molecular Weight | 459.71 g/mol |
| Exact Mass | 458.99 |
| IUPAC Name | (E)-3-(4-chloro-2-iodoanilino)-1,3-diphenylprop-2-en-1-one |
| SMILES | O=C(/C=C(/Nc1ccc(Cl)cc1I)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H15ClINO/c22-17-11-12-19(18(23)13-17)24-20(15-7-3-1-4-8-15)14-21(25)16-9-5-2-6-10-16/h1-14,24H/b20-14+ |
| InChIKey | HEHSBEUYCDXCRK-XSFVSMFZSA-N |
| XLogP | 6.28 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.71 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|