C29H22ClNO — CID 135072365
(Z)-3-[4-chloro-2-[(E)-2-phenylethenyl]anilino]-1,3-diphenylprop-2-en-1-one (PubChem CID 135072365) has the molecular formula C29H22ClNO and a molecular weight of 435.95 g/mol. Its IUPAC name is (Z)-3-[4-chloro-2-[(E)-2-phenylethenyl]anilino]-1,3-diphenylprop-2-en-1-one.
| Compound Name | (Z)-3-[4-chloro-2-[(E)-2-phenylethenyl]anilino]-1,3-diphenylprop-2-en-1-one |
|---|---|
| PubChem CID | 135072365 |
| Molecular Formula | C29H22ClNO |
| Molecular Weight | 435.95 g/mol |
| Exact Mass | 435.14 |
| IUPAC Name | (Z)-3-[4-chloro-2-[(E)-2-phenylethenyl]anilino]-1,3-diphenylprop-2-en-1-one |
| SMILES | O=C(/C=C(\Nc1ccc(Cl)cc1/C=C/c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H22ClNO/c30-26-18-19-27(25(20-26)17-16-22-10-4-1-5-11-22)31-28(23-12-6-2-7-13-23)21-29(32)24-14-8-3-9-15-24/h1-21,31H/b17-16+,28-21- |
| InChIKey | DGBVIWPLXFWRSN-YHCDYRNHSA-N |
| XLogP | 7.85 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.95 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|