C18H19Cl2NO2 — CID 66724785
(3R)-3-[4-chloro-2-(2-phenylethenyl)anilino]butanoic acid;hydrochloride (PubChem CID 66724785) has the molecular formula C18H19Cl2NO2 and a molecular weight of 352.26 g/mol. Its IUPAC name is (3R)-3-[4-chloro-2-(2-phenylethenyl)anilino]butanoic acid;hydrochloride.
| Compound Name | (3R)-3-[4-chloro-2-(2-phenylethenyl)anilino]butanoic acid;hydrochloride |
|---|---|
| PubChem CID | 66724785 |
| Molecular Formula | C18H19Cl2NO2 |
| Molecular Weight | 352.26 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | (3R)-3-[4-chloro-2-(2-phenylethenyl)anilino]butanoic acid;hydrochloride |
| SMILES | C[C@H](CC(=O)O)Nc1ccc(Cl)cc1C=Cc1ccccc1.Cl |
| InChI | InChI=1S/C18H18ClNO2.ClH/c1-13(11-18(21)22)20-17-10-9-16(19)12-15(17)8-7-14-5-3-2-4-6-14;/h2-10,12-13,20H,11H2,1H3,(H,21,22);1H/t13-;/m1./s1 |
| InChIKey | XJUYODBBJVPDML-BTQNPOSSSA-N |
| XLogP | 5.21 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.26 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|