C30H42N4O4 — CID 166437448
tert-butyl 4-[5-[(E)-4-[benzyl(2,2-dimethylpropanoyloxy)amino]but-1-enyl]-2-pyridinyl]piperazine-1-carboxylate (PubChem CID 166437448) has the molecular formula C30H42N4O4 and a molecular weight of 522.69 g/mol. Its IUPAC name is tert-butyl 4-[5-[(E)-4-[benzyl(2,2-dimethylpropanoyloxy)amino]but-1-enyl]-2-pyridinyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[5-[(E)-4-[benzyl(2,2-dimethylpropanoyloxy)amino]but-1-enyl]-2-pyridinyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 166437448 |
| Molecular Formula | C30H42N4O4 |
| Molecular Weight | 522.69 g/mol |
| Exact Mass | 522.32 |
| IUPAC Name | tert-butyl 4-[5-[(E)-4-[benzyl(2,2-dimethylpropanoyloxy)amino]but-1-enyl]-2-pyridinyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccc(/C=C/CCN(Cc3ccccc3)OC(=O)C(C)(C)C)cn2)CC1 |
| InChI | InChI=1S/C30H42N4O4/c1-29(2,3)27(35)38-34(23-25-13-8-7-9-14-25)17-11-10-12-24-15-16-26(31-22-24)32-18-20-33(21-19-32)28(36)37-30(4,5)6/h7-10,12-16,22H,11,17-21,23H2,1-6H3/b12-10+ |
| InChIKey | ZGEJEDZGQAVWQX-ZRDIBKRKSA-N |
| XLogP | 5.55 |
| TPSA | 75.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.69 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|