C15H30OSi2 — CID 166438595
2,2-dimethyl-5,7-bis(trimethylsilyl)hept-6-yn-3-one (PubChem CID 166438595) has the molecular formula C15H30OSi2 and a molecular weight of 282.58 g/mol. Its IUPAC name is 2,2-dimethyl-5,7-bis(trimethylsilyl)hept-6-yn-3-one.
| Compound Name | 2,2-dimethyl-5,7-bis(trimethylsilyl)hept-6-yn-3-one |
|---|---|
| PubChem CID | 166438595 |
| Molecular Formula | C15H30OSi2 |
| Molecular Weight | 282.58 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | 2,2-dimethyl-5,7-bis(trimethylsilyl)hept-6-yn-3-one |
| SMILES | CC(C)(C)C(=O)CC(C#C[Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C15H30OSi2/c1-15(2,3)14(16)12-13(18(7,8)9)10-11-17(4,5)6/h13H,12H2,1-9H3 |
| InChIKey | LEQYUEPTVJDLOS-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.58 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|