C18H34OSi — CID 59628205
6,6-dimethyl-1-tri(propan-2-yl)silylhept-1-yn-4-one (PubChem CID 59628205) has the molecular formula C18H34OSi and a molecular weight of 294.56 g/mol. Its IUPAC name is 6,6-dimethyl-1-tri(propan-2-yl)silylhept-1-yn-4-one.
| Compound Name | 6,6-dimethyl-1-tri(propan-2-yl)silylhept-1-yn-4-one |
|---|---|
| PubChem CID | 59628205 |
| Molecular Formula | C18H34OSi |
| Molecular Weight | 294.56 g/mol |
| Exact Mass | 294.24 |
| IUPAC Name | 6,6-dimethyl-1-tri(propan-2-yl)silylhept-1-yn-4-one |
| SMILES | CC(C)[Si](C#CCC(=O)CC(C)(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C18H34OSi/c1-14(2)20(15(3)4,16(5)6)12-10-11-17(19)13-18(7,8)9/h14-16H,11,13H2,1-9H3 |
| InChIKey | OHDJPOGJBSNOKB-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.56 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|