C13H24OSi — CID 10900276
2,2,4-trimethyl-7-trimethylsilylhept-5-yn-3-one (PubChem CID 10900276) has the molecular formula C13H24OSi and a molecular weight of 224.42 g/mol. Its IUPAC name is 2,2,4-trimethyl-7-trimethylsilylhept-5-yn-3-one.
| Compound Name | 2,2,4-trimethyl-7-trimethylsilylhept-5-yn-3-one |
|---|---|
| PubChem CID | 10900276 |
| Molecular Formula | C13H24OSi |
| Molecular Weight | 224.42 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | 2,2,4-trimethyl-7-trimethylsilylhept-5-yn-3-one |
| SMILES | CC(C#CC[Si](C)(C)C)C(=O)C(C)(C)C |
| InChI | InChI=1S/C13H24OSi/c1-11(12(14)13(2,3)4)9-8-10-15(5,6)7/h11H,10H2,1-7H3 |
| InChIKey | IVQHGOPIMSHFRV-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.42 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|