C16H30OSi — CID 42637685
4,4-dimethyl-1-tri(propan-2-yl)silylpent-1-yn-3-one (PubChem CID 42637685) has the molecular formula C16H30OSi and a molecular weight of 266.50 g/mol. Its IUPAC name is 4,4-dimethyl-1-tri(propan-2-yl)silylpent-1-yn-3-one.
| Compound Name | 4,4-dimethyl-1-tri(propan-2-yl)silylpent-1-yn-3-one |
|---|---|
| PubChem CID | 42637685 |
| Molecular Formula | C16H30OSi |
| Molecular Weight | 266.50 g/mol |
| Exact Mass | 266.21 |
| IUPAC Name | 4,4-dimethyl-1-tri(propan-2-yl)silylpent-1-yn-3-one |
| SMILES | CC(C)[Si](C#CC(=O)C(C)(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C16H30OSi/c1-12(2)18(13(3)4,14(5)6)11-10-15(17)16(7,8)9/h12-14H,1-9H3 |
| InChIKey | FMESUNHCQRQTBO-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.50 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|