C19H14F3NO2 — CID 166438740
[2-(4-methoxyphenyl)-5-(trifluoromethyl)phenyl]-pyrrol-1-ylmethanone (PubChem CID 166438740) has the molecular formula C19H14F3NO2 and a molecular weight of 345.32 g/mol. Its IUPAC name is [2-(4-methoxyphenyl)-5-(trifluoromethyl)phenyl]-pyrrol-1-ylmethanone.
| Compound Name | [2-(4-methoxyphenyl)-5-(trifluoromethyl)phenyl]-pyrrol-1-ylmethanone |
|---|---|
| PubChem CID | 166438740 |
| Molecular Formula | C19H14F3NO2 |
| Molecular Weight | 345.32 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | [2-(4-methoxyphenyl)-5-(trifluoromethyl)phenyl]-pyrrol-1-ylmethanone |
| SMILES | COc1ccc(-c2ccc(C(F)(F)F)cc2C(=O)n2cccc2)cc1 |
| InChI | InChI=1S/C19H14F3NO2/c1-25-15-7-4-13(5-8-15)16-9-6-14(19(20,21)22)12-17(16)18(24)23-10-2-3-11-23/h2-12H,1H3 |
| InChIKey | ISSDWKZJUHFLMK-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.32 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |