C8H16O3S — CID 166439306
cis-(1S,2R)-2-methylsulfonylcycloheptan-1-ol (PubChem CID 166439306) has the molecular formula C8H16O3S and a molecular weight of 192.28 g/mol. Its IUPAC name is cis-(1S,2R)-2-methylsulfonylcycloheptan-1-ol.
| Compound Name | cis-(1S,2R)-2-methylsulfonylcycloheptan-1-ol |
|---|---|
| PubChem CID | 166439306 |
| Molecular Formula | C8H16O3S |
| Molecular Weight | 192.28 g/mol |
| Exact Mass | 192.08 |
| IUPAC Name | cis-(1S,2R)-2-methylsulfonylcycloheptan-1-ol |
| SMILES | CS(=O)(=O)[C@@H]1CCCCC[C@@H]1O |
| InChI | InChI=1S/C8H16O3S/c1-12(10,11)8-6-4-2-3-5-7(8)9/h7-9H,2-6H2,1H3/t7-,8+/m0/s1 |
| InChIKey | YOUOQQXGLHLVHT-JGVFFNPUSA-N |
| XLogP | 0.72 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.28 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |